C20H26N6O2 — CID 90390203
6-[(1-amino-3-oxopropan-2-yl)amino]-2-(4-benzylpiperidin-1-yl)pyrimidine-4-carboxamide (PubChem CID 90390203) has the molecular formula C20H26N6O2 and a molecular weight of 382.47 g/mol. Its IUPAC name is 6-[(1-amino-3-oxopropan-2-yl)amino]-2-(4-benzylpiperidin-1-yl)pyrimidine-4-carboxamide.
| Compound Name | 6-[(1-amino-3-oxopropan-2-yl)amino]-2-(4-benzylpiperidin-1-yl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 90390203 |
| Molecular Formula | C20H26N6O2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 6-[(1-amino-3-oxopropan-2-yl)amino]-2-(4-benzylpiperidin-1-yl)pyrimidine-4-carboxamide |
| SMILES | NCC(C=O)Nc1cc(C(N)=O)nc(N2CCC(Cc3ccccc3)CC2)n1 |
| InChI | InChI=1S/C20H26N6O2/c21-12-16(13-27)23-18-11-17(19(22)28)24-20(25-18)26-8-6-15(7-9-26)10-14-4-2-1-3-5-14/h1-5,11,13,15-16H,6-10,12,21H2,(H2,22,28)(H,23,24,25) |
| InChIKey | GPQCCZDLSSNDKQ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 127.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|