C19H23ClFN3O — CID 123472685
N-[1-[[6-(2-chloro-5-fluoro-4-pyridinyl)-2-methyl-3-pyridinyl]oxy]-2,4-dimethylpentan-2-yl]methanimine (PubChem CID 123472685) has the molecular formula C19H23ClFN3O and a molecular weight of 363.86 g/mol. Its IUPAC name is N-[1-[[6-(2-chloro-5-fluoro-4-pyridinyl)-2-methyl-3-pyridinyl]oxy]-2,4-dimethylpentan-2-yl]methanimine.
| Compound Name | N-[1-[[6-(2-chloro-5-fluoro-4-pyridinyl)-2-methyl-3-pyridinyl]oxy]-2,4-dimethylpentan-2-yl]methanimine |
|---|---|
| PubChem CID | 123472685 |
| Molecular Formula | C19H23ClFN3O |
| Molecular Weight | 363.86 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | N-[1-[[6-(2-chloro-5-fluoro-4-pyridinyl)-2-methyl-3-pyridinyl]oxy]-2,4-dimethylpentan-2-yl]methanimine |
| SMILES | C=NC(C)(COc1ccc(-c2cc(Cl)ncc2F)nc1C)CC(C)C |
| InChI | InChI=1S/C19H23ClFN3O/c1-12(2)9-19(4,22-5)11-25-17-7-6-16(24-13(17)3)14-8-18(20)23-10-15(14)21/h6-8,10,12H,5,9,11H2,1-4H3 |
| InChIKey | YQGVVZZNPQGMJY-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 47.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.86 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|