C13H20N2 — CID 123472964
1-methyl-4-(7-methylocta-4,6-dien-4-yl)pyrazole (PubChem CID 123472964) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is 1-methyl-4-(7-methylocta-4,6-dien-4-yl)pyrazole.
| Compound Name | 1-methyl-4-(7-methylocta-4,6-dien-4-yl)pyrazole |
|---|---|
| PubChem CID | 123472964 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 1-methyl-4-(7-methylocta-4,6-dien-4-yl)pyrazole |
| SMILES | CCCC(=CC=C(C)C)c1cnn(C)c1 |
| InChI | InChI=1S/C13H20N2/c1-5-6-12(8-7-11(2)3)13-9-14-15(4)10-13/h7-10H,5-6H2,1-4H3 |
| InChIKey | RDDMNTPHZXWNNS-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|