C23H31F2N6O+ — CID 123473019
[5-carbamoyl-6-(2,3-dihydro-1H-inden-5-ylamino)pyrazin-2-yl]-[3,3-difluoro-2-(methylamino)cyclohexyl]-dimethylazanium (PubChem CID 123473019) has the molecular formula C23H31F2N6O+ and a molecular weight of 445.54 g/mol. Its IUPAC name is [5-carbamoyl-6-(2,3-dihydro-1H-inden-5-ylamino)pyrazin-2-yl]-[3,3-difluoro-2-(methylamino)cyclohexyl]-dimethylazanium.
| Compound Name | [5-carbamoyl-6-(2,3-dihydro-1H-inden-5-ylamino)pyrazin-2-yl]-[3,3-difluoro-2-(methylamino)cyclohexyl]-dimethylazanium |
|---|---|
| PubChem CID | 123473019 |
| Molecular Formula | C23H31F2N6O+ |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | [5-carbamoyl-6-(2,3-dihydro-1H-inden-5-ylamino)pyrazin-2-yl]-[3,3-difluoro-2-(methylamino)cyclohexyl]-dimethylazanium |
| SMILES | CNC1C([N+](C)(C)c2cnc(C(N)=O)c(Nc3ccc4c(c3)CCC4)n2)CCCC1(F)F |
| InChI | InChI=1S/C23H30F2N6O/c1-27-20-17(8-5-11-23(20,24)25)31(2,3)18-13-28-19(21(26)32)22(30-18)29-16-10-9-14-6-4-7-15(14)12-16/h9-10,12-13,17,20,27H,4-8,11H2,1-3H3,(H2-,26,29,30,32)/p+1 |
| InChIKey | NOTRKQAXWPCGQZ-UHFFFAOYSA-O |
| XLogP | 3.15 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|