C21H26F2N7OS+ — CID 123330099
[4-(1,3-benzothiazol-5-ylamino)-5-carbamoylpyrimidin-2-yl]-[3,3-difluoro-2-(methylamino)cyclohexyl]-dimethylazanium (PubChem CID 123330099) has the molecular formula C21H26F2N7OS+ and a molecular weight of 462.55 g/mol. Its IUPAC name is [4-(1,3-benzothiazol-5-ylamino)-5-carbamoylpyrimidin-2-yl]-[3,3-difluoro-2-(methylamino)cyclohexyl]-dimethylazanium.
| Compound Name | [4-(1,3-benzothiazol-5-ylamino)-5-carbamoylpyrimidin-2-yl]-[3,3-difluoro-2-(methylamino)cyclohexyl]-dimethylazanium |
|---|---|
| PubChem CID | 123330099 |
| Molecular Formula | C21H26F2N7OS+ |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | [4-(1,3-benzothiazol-5-ylamino)-5-carbamoylpyrimidin-2-yl]-[3,3-difluoro-2-(methylamino)cyclohexyl]-dimethylazanium |
| SMILES | CNC1C([N+](C)(C)c2ncc(C(N)=O)c(Nc3ccc4scnc4c3)n2)CCCC1(F)F |
| InChI | InChI=1S/C21H25F2N7OS/c1-25-17-15(5-4-8-21(17,22)23)30(2,3)20-26-10-13(18(24)31)19(29-20)28-12-6-7-16-14(9-12)27-11-32-16/h6-7,9-11,15,17,25H,4-5,8H2,1-3H3,(H2-,24,26,28,29,31)/p+1 |
| InChIKey | LDJYZRLLHFEZKW-UHFFFAOYSA-O |
| XLogP | 3.27 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|