C9H19NS2 — CID 123473527
1-(4-ethylpiperidin-1-yl)ethane-1,2-dithiol (PubChem CID 123473527) has the molecular formula C9H19NS2 and a molecular weight of 205.39 g/mol. Its IUPAC name is 1-(4-ethylpiperidin-1-yl)ethane-1,2-dithiol.
| Compound Name | 1-(4-ethylpiperidin-1-yl)ethane-1,2-dithiol |
|---|---|
| PubChem CID | 123473527 |
| Molecular Formula | C9H19NS2 |
| Molecular Weight | 205.39 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | 1-(4-ethylpiperidin-1-yl)ethane-1,2-dithiol |
| SMILES | CCC1CCN(C(S)CS)CC1 |
| InChI | InChI=1S/C9H19NS2/c1-2-8-3-5-10(6-4-8)9(12)7-11/h8-9,11-12H,2-7H2,1H3 |
| InChIKey | HUGJLCAHQJTJTP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.39 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|