About 1-(4-ethylpiperidin-1-yl)ethane-1,2-dithiol
1-(4-ethylpiperidin-1-yl)ethane-1,2-dithiol (PubChem CID 123473527) has the molecular formula C9H19NS2
and a molecular weight of 205.39 g/mol. Its IUPAC name is 1-(4-ethylpiperidin-1-yl)ethane-1,2-dithiol.
Molecular Properties
| Compound Name | 1-(4-ethylpiperidin-1-yl)ethane-1,2-dithiol |
| PubChem CID | 123473527 |
| Molecular Formula | C9H19NS2 |
| Molecular Weight | 205.39 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | 1-(4-ethylpiperidin-1-yl)ethane-1,2-dithiol |
| SMILES | CCC1CCN(C(S)CS)CC1 |
| InChI | InChI=1S/C9H19NS2/c1-2-8-3-5-10(6-4-8)9(12)7-11/h8-9,11-12H,2-7H2,1H3 |
| InChIKey | HUGJLCAHQJTJTP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.39 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-ethylpiperidin-1-yl)ethane-1,2-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-ethylpiperidin-1-yl)ethane-1,2-dithiol?
The IUPAC name of 1-(4-ethylpiperidin-1-yl)ethane-1,2-dithiol (CID 123473527) is 1-(4-ethylpiperidin-1-yl)ethane-1,2-dithiol.
What is the SMILES notation for 1-(4-ethylpiperidin-1-yl)ethane-1,2-dithiol?
The canonical SMILES for 1-(4-ethylpiperidin-1-yl)ethane-1,2-dithiol is CCC1CCN(C(S)CS)CC1.
What is the InChIKey of 1-(4-ethylpiperidin-1-yl)ethane-1,2-dithiol?
The InChIKey is HUGJLCAHQJTJTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NS2/c1-2-8-3-5-10(6-4-8)9(12)7-11/h8-9,11-12H,2-7H2,1H3.
What are the key properties of 1-(4-ethylpiperidin-1-yl)ethane-1,2-dithiol?
1-(4-ethylpiperidin-1-yl)ethane-1,2-dithiol has a molecular weight of 205.39 g/mol, XLogP of 2.29, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-ethylpiperidin-1-yl)ethane-1,2-dithiol is sourced from PubChem (CID 123473527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).