C26H50O3Si — CID 123474144
3-[tert-butyl(dimethyl)silyl]oxyicosa-11,14-dienoic acid (PubChem CID 123474144) has the molecular formula C26H50O3Si and a molecular weight of 438.77 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxyicosa-11,14-dienoic acid.
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxyicosa-11,14-dienoic acid |
|---|---|
| PubChem CID | 123474144 |
| Molecular Formula | C26H50O3Si |
| Molecular Weight | 438.77 g/mol |
| Exact Mass | 438.35 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxyicosa-11,14-dienoic acid |
| SMILES | CCCCCC=CCC=CCCCCCCCC(CC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H50O3Si/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-24(23-25(27)28)29-30(5,6)26(2,3)4/h11-12,14-15,24H,7-10,13,16-23H2,1-6H3,(H,27,28) |
| InChIKey | UDDRJRGWTMLHEQ-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.77 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|