C7H9N3 — CID 123474456
3,3a,4,7a-tetrahydrobenzimidazol-5-imine (PubChem CID 123474456) has the molecular formula C7H9N3 and a molecular weight of 135.17 g/mol. Its IUPAC name is 3,3a,4,7a-tetrahydrobenzimidazol-5-imine.
| Compound Name | 3,3a,4,7a-tetrahydrobenzimidazol-5-imine |
|---|---|
| PubChem CID | 123474456 |
| Molecular Formula | C7H9N3 |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.08 |
| IUPAC Name | 3,3a,4,7a-tetrahydrobenzimidazol-5-imine |
| SMILES | [H]/N=C1\C=CC2N=CNC2C1 |
| InChI | InChI=1S/C7H9N3/c8-5-1-2-6-7(3-5)10-4-9-6/h1-2,4,6-8H,3H2,(H,9,10)/b8-5+ |
| InChIKey | WRFKBIDHEPMOOY-VMPITWQZSA-N |
| XLogP | 0.33 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|