C7H11N3 — CID 90697220
3,3a,4,5-tetrahydro-2H-benzimidazol-4-amine (PubChem CID 90697220) has the molecular formula C7H11N3 and a molecular weight of 137.19 g/mol. Its IUPAC name is 3,3a,4,5-tetrahydro-2H-benzimidazol-4-amine.
| Compound Name | 3,3a,4,5-tetrahydro-2H-benzimidazol-4-amine |
|---|---|
| PubChem CID | 90697220 |
| Molecular Formula | C7H11N3 |
| Molecular Weight | 137.19 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | 3,3a,4,5-tetrahydro-2H-benzimidazol-4-amine |
| SMILES | NC1CC=CC2=NCNC21 |
| InChI | InChI=1S/C7H11N3/c8-5-2-1-3-6-7(5)10-4-9-6/h1,3,5,7,10H,2,4,8H2 |
| InChIKey | GDNHKMVLPGNVTB-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.19 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |