C7H11N3 — CID 90795506
1,2,3,3a,4,7a-hexahydrobenzimidazol-5-imine (PubChem CID 90795506) has the molecular formula C7H11N3 and a molecular weight of 137.19 g/mol. Its IUPAC name is 1,2,3,3a,4,7a-hexahydrobenzimidazol-5-imine.
| Compound Name | 1,2,3,3a,4,7a-hexahydrobenzimidazol-5-imine |
|---|---|
| PubChem CID | 90795506 |
| Molecular Formula | C7H11N3 |
| Molecular Weight | 137.19 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | 1,2,3,3a,4,7a-hexahydrobenzimidazol-5-imine |
| SMILES | [H]/N=C1\C=CC2NCNC2C1 |
| InChI | InChI=1S/C7H11N3/c8-5-1-2-6-7(3-5)10-4-9-6/h1-2,6-10H,3-4H2/b8-5+ |
| InChIKey | DCDRKAZNEZZPEH-VMPITWQZSA-N |
| XLogP | -0.15 |
| TPSA | 47.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.19 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|