C12H19N5 — CID 123474685
1-(5-methylimino-2-prop-1-enylpent-2-enyl)pyrazole-4,5-diamine (PubChem CID 123474685) has the molecular formula C12H19N5 and a molecular weight of 233.32 g/mol. Its IUPAC name is 1-(5-methylimino-2-prop-1-enylpent-2-enyl)pyrazole-4,5-diamine.
| Compound Name | 1-(5-methylimino-2-prop-1-enylpent-2-enyl)pyrazole-4,5-diamine |
|---|---|
| PubChem CID | 123474685 |
| Molecular Formula | C12H19N5 |
| Molecular Weight | 233.32 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | 1-(5-methylimino-2-prop-1-enylpent-2-enyl)pyrazole-4,5-diamine |
| SMILES | CC=CC(=CC/C=N/C)Cn1ncc(N)c1N |
| InChI | InChI=1S/C12H19N5/c1-3-5-10(6-4-7-15-2)9-17-12(14)11(13)8-16-17/h3,5-8H,4,9,13-14H2,1-2H3/b5-3?,10-6?,15-7+ |
| InChIKey | VIYBDLBFFCHGNT-DJNFGGAXSA-N |
| XLogP | 1.64 |
| TPSA | 82.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.32 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|