C7H13N5 — CID 21018100
1-[(E)-4-aminobut-2-enyl]pyrazole-4,5-diamine (PubChem CID 21018100) has the molecular formula C7H13N5 and a molecular weight of 167.22 g/mol. Its IUPAC name is 1-[(E)-4-aminobut-2-enyl]pyrazole-4,5-diamine.
| Compound Name | 1-[(E)-4-aminobut-2-enyl]pyrazole-4,5-diamine |
|---|---|
| PubChem CID | 21018100 |
| Molecular Formula | C7H13N5 |
| Molecular Weight | 167.22 g/mol |
| Exact Mass | 167.12 |
| IUPAC Name | 1-[(E)-4-aminobut-2-enyl]pyrazole-4,5-diamine |
| SMILES | NC/C=C/Cn1ncc(N)c1N |
| InChI | InChI=1S/C7H13N5/c8-3-1-2-4-12-7(10)6(9)5-11-12/h1-2,5H,3-4,8-10H2/b2-1+ |
| InChIKey | RADNORZGRPTLGI-OWOJBTEDSA-N |
| XLogP | -0.44 |
| TPSA | 95.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.22 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|