C13H11ClN4 — CID 123474723
5-chloro-4-(1H-indol-4-yl)-N-methylpyrimidin-2-amine (PubChem CID 123474723) has the molecular formula C13H11ClN4 and a molecular weight of 258.71 g/mol. Its IUPAC name is 5-chloro-4-(1H-indol-4-yl)-N-methylpyrimidin-2-amine.
| Compound Name | 5-chloro-4-(1H-indol-4-yl)-N-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 123474723 |
| Molecular Formula | C13H11ClN4 |
| Molecular Weight | 258.71 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 5-chloro-4-(1H-indol-4-yl)-N-methylpyrimidin-2-amine |
| SMILES | CNc1ncc(Cl)c(-c2cccc3[nH]ccc23)n1 |
| InChI | InChI=1S/C13H11ClN4/c1-15-13-17-7-10(14)12(18-13)9-3-2-4-11-8(9)5-6-16-11/h2-7,16H,1H3,(H,15,17,18) |
| InChIKey | RDDIQHLAYXDAPM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.71 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |