About 1-[5,6-diamino-2-(tert-butylamino)pyrimidin-4-yl]pyrrolidin-3-ol
1-[5,6-diamino-2-(tert-butylamino)pyrimidin-4-yl]pyrrolidin-3-ol (PubChem CID 123475270) has the molecular formula C12H22N6O
and a molecular weight of 266.35 g/mol. Its IUPAC name is 1-[5,6-diamino-2-(tert-butylamino)pyrimidin-4-yl]pyrrolidin-3-ol.
Molecular Properties
| Compound Name | 1-[5,6-diamino-2-(tert-butylamino)pyrimidin-4-yl]pyrrolidin-3-ol |
| PubChem CID | 123475270 |
| Molecular Formula | C12H22N6O |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 1-[5,6-diamino-2-(tert-butylamino)pyrimidin-4-yl]pyrrolidin-3-ol |
| SMILES | CC(C)(C)Nc1nc(N)c(N)c(N2CCC(O)C2)n1 |
| InChI | InChI=1S/C12H22N6O/c1-12(2,3)17-11-15-9(14)8(13)10(16-11)18-5-4-7(19)6-18/h7,19H,4-6,13H2,1-3H3,(H3,14,15,16,17) |
| InChIKey | FBNKRYOLXZXINE-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[5,6-diamino-2-(tert-butylamino)pyrimidin-4-yl]pyrrolidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5,6-diamino-2-(tert-butylamino)pyrimidin-4-yl]pyrrolidin-3-ol?
The IUPAC name of 1-[5,6-diamino-2-(tert-butylamino)pyrimidin-4-yl]pyrrolidin-3-ol (CID 123475270) is 1-[5,6-diamino-2-(tert-butylamino)pyrimidin-4-yl]pyrrolidin-3-ol.
What is the SMILES notation for 1-[5,6-diamino-2-(tert-butylamino)pyrimidin-4-yl]pyrrolidin-3-ol?
The canonical SMILES for 1-[5,6-diamino-2-(tert-butylamino)pyrimidin-4-yl]pyrrolidin-3-ol is CC(C)(C)Nc1nc(N)c(N)c(N2CCC(O)C2)n1.
What is the InChIKey of 1-[5,6-diamino-2-(tert-butylamino)pyrimidin-4-yl]pyrrolidin-3-ol?
The InChIKey is FBNKRYOLXZXINE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N6O/c1-12(2,3)17-11-15-9(14)8(13)10(16-11)18-5-4-7(19)6-18/h7,19H,4-6,13H2,1-3H3,(H3,14,15,16,17).
What are the key properties of 1-[5,6-diamino-2-(tert-butylamino)pyrimidin-4-yl]pyrrolidin-3-ol?
1-[5,6-diamino-2-(tert-butylamino)pyrimidin-4-yl]pyrrolidin-3-ol has a molecular weight of 266.35 g/mol, XLogP of 0.42, 2 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5,6-diamino-2-(tert-butylamino)pyrimidin-4-yl]pyrrolidin-3-ol is sourced from PubChem (CID 123475270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).