C33H35F7N4O5 — CID 123477714
1-[3,5-bis(trifluoromethyl)phenyl]-3-[1-[4-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)cyclohexanecarbonyl]-4-(4-fluorophenyl)pyrrolidin-3-yl]-1,3-dimethylurea (PubChem CID 123477714) has the molecular formula C33H35F7N4O5 and a molecular weight of 700.65 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-[1-[4-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)cyclohexanecarbonyl]-4-(4-fluorophenyl)pyrrolidin-3-yl]-1,3-dimethylurea.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[1-[4-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)cyclohexanecarbonyl]-4-(4-fluorophenyl)pyrrolidin-3-yl]-1,3-dimethylurea |
|---|---|
| PubChem CID | 123477714 |
| Molecular Formula | C33H35F7N4O5 |
| Molecular Weight | 700.65 g/mol |
| Exact Mass | 700.25 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[1-[4-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)cyclohexanecarbonyl]-4-(4-fluorophenyl)pyrrolidin-3-yl]-1,3-dimethylurea |
| SMILES | CN(C(=O)N(C)C1CN(C(=O)C2CCC(N3C(=O)OC(C)(C)C3=O)CC2)CC1c1ccc(F)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C33H35F7N4O5/c1-31(2)28(46)44(30(48)49-31)23-11-7-19(8-12-23)27(45)43-16-25(18-5-9-22(34)10-6-18)26(17-43)42(4)29(47)41(3)24-14-20(32(35,36)37)13-21(15-24)33(38,39)40/h5-6,9-10,13-15,19,23,25-26H,7-8,11-12,16-17H2,1-4H3 |
| InChIKey | PNFRQMLNZISFRA-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 90.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.65 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |