C14H28NO2P — CID 123478712
cyclooct-4-en-1-yloxy-N,N-di(propan-2-yl)phosphonamidous acid (PubChem CID 123478712) has the molecular formula C14H28NO2P and a molecular weight of 273.36 g/mol. Its IUPAC name is cyclooct-4-en-1-yloxy-N,N-di(propan-2-yl)phosphonamidous acid.
| Compound Name | cyclooct-4-en-1-yloxy-N,N-di(propan-2-yl)phosphonamidous acid |
|---|---|
| PubChem CID | 123478712 |
| Molecular Formula | C14H28NO2P |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.19 |
| IUPAC Name | cyclooct-4-en-1-yloxy-N,N-di(propan-2-yl)phosphonamidous acid |
| SMILES | CC(C)N(C(C)C)P(O)OC1CCC=CCCC1 |
| InChI | InChI=1S/C14H28NO2P/c1-12(2)15(13(3)4)18(16)17-14-10-8-6-5-7-9-11-14/h5-6,12-14,16H,7-11H2,1-4H3 |
| InChIKey | MIDZSVNSBCBCTG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|