C11H19NO2 — CID 90049693
[(4E)-cyclooct-4-en-1-yl] N,N-dimethylcarbamate (PubChem CID 90049693) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is [(4E)-cyclooct-4-en-1-yl] N,N-dimethylcarbamate.
| Compound Name | [(4E)-cyclooct-4-en-1-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 90049693 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | [(4E)-cyclooct-4-en-1-yl] N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)OC1CC/C=C\CCC1 |
| InChI | InChI=1S/C11H19NO2/c1-12(2)11(13)14-10-8-6-4-3-5-7-9-10/h3-4,10H,5-9H2,1-2H3/b4-3- |
| InChIKey | WPRLAVWXNOMLNK-ARJAWSKDSA-N |
| XLogP | 2.57 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|