C24H37N3O3 — CID 123479609
(8R,9S,10R,13S,14S)-3-[(1R,2S)-2-aminocyclopentyl]oxyimino-10,13-dimethyl-6-nitroso-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one (PubChem CID 123479609) has the molecular formula C24H37N3O3 and a molecular weight of 415.58 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-3-[(1R,2S)-2-aminocyclopentyl]oxyimino-10,13-dimethyl-6-nitroso-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,10R,13S,14S)-3-[(1R,2S)-2-aminocyclopentyl]oxyimino-10,13-dimethyl-6-nitroso-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 123479609 |
| Molecular Formula | C24H37N3O3 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.28 |
| IUPAC Name | (8R,9S,10R,13S,14S)-3-[(1R,2S)-2-aminocyclopentyl]oxyimino-10,13-dimethyl-6-nitroso-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CCC(=NO[C@@H]3CCC[C@@H]3N)CC1C(N=O)C[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C24H37N3O3/c1-23-10-8-14(27-30-21-5-3-4-19(21)25)12-18(23)20(26-29)13-15-16-6-7-22(28)24(16,2)11-9-17(15)23/h15-21H,3-13,25H2,1-2H3/t15-,16-,17-,18?,19-,20?,21+,23+,24-/m0/s1 |
| InChIKey | YUZODAATZIHELD-QIYLNEMFSA-N |
| XLogP | 4.60 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|