C28H33ClO10 — CID 123480356
[3,4,5-triacetyloxy-6-[4-(1-chloropropan-2-yl)-3-methylnaphthalen-1-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 123480356) has the molecular formula C28H33ClO10 and a molecular weight of 565.02 g/mol. Its IUPAC name is [3,4,5-triacetyloxy-6-[4-(1-chloropropan-2-yl)-3-methylnaphthalen-1-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [3,4,5-triacetyloxy-6-[4-(1-chloropropan-2-yl)-3-methylnaphthalen-1-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 123480356 |
| Molecular Formula | C28H33ClO10 |
| Molecular Weight | 565.02 g/mol |
| Exact Mass | 564.18 |
| IUPAC Name | [3,4,5-triacetyloxy-6-[4-(1-chloropropan-2-yl)-3-methylnaphthalen-1-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(Oc2cc(C)c(C(C)CCl)c3ccccc23)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C28H33ClO10/c1-14-11-22(20-9-7-8-10-21(20)24(14)15(2)12-29)38-28-27(37-19(6)33)26(36-18(5)32)25(35-17(4)31)23(39-28)13-34-16(3)30/h7-11,15,23,25-28H,12-13H2,1-6H3 |
| InChIKey | XKNBVEILWMEVHV-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.02 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|