C10H11N3O3 — CID 123480725
5,5-dimethyl-3-(6-oxo-1H-pyridin-3-yl)imidazolidine-2,4-dione (PubChem CID 123480725) has the molecular formula C10H11N3O3 and a molecular weight of 221.22 g/mol. Its IUPAC name is 5,5-dimethyl-3-(6-oxo-1H-pyridin-3-yl)imidazolidine-2,4-dione.
| Compound Name | 5,5-dimethyl-3-(6-oxo-1H-pyridin-3-yl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 123480725 |
| Molecular Formula | C10H11N3O3 |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | 5,5-dimethyl-3-(6-oxo-1H-pyridin-3-yl)imidazolidine-2,4-dione |
| SMILES | CC1(C)NC(=O)N(c2ccc(=O)[nH]c2)C1=O |
| InChI | InChI=1S/C10H11N3O3/c1-10(2)8(15)13(9(16)12-10)6-3-4-7(14)11-5-6/h3-5H,1-2H3,(H,11,14)(H,12,16) |
| InChIKey | QJNGNEFENGJTES-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|