C31H40N4O6 — CID 123484213
benzhydryl 3-[4-[amino-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethylamino]methyl]phenoxy]-2-aminooxypropanoate (PubChem CID 123484213) has the molecular formula C31H40N4O6 and a molecular weight of 564.68 g/mol. Its IUPAC name is benzhydryl 3-[4-[amino-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethylamino]methyl]phenoxy]-2-aminooxypropanoate.
| Compound Name | benzhydryl 3-[4-[amino-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethylamino]methyl]phenoxy]-2-aminooxypropanoate |
|---|---|
| PubChem CID | 123484213 |
| Molecular Formula | C31H40N4O6 |
| Molecular Weight | 564.68 g/mol |
| Exact Mass | 564.29 |
| IUPAC Name | benzhydryl 3-[4-[amino-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethylamino]methyl]phenoxy]-2-aminooxypropanoate |
| SMILES | CN(CCNC(N)c1ccc(OCC(ON)C(=O)OC(c2ccccc2)c2ccccc2)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H40N4O6/c1-31(2,3)40-30(37)35(4)20-19-34-28(32)24-15-17-25(18-16-24)38-21-26(41-33)29(36)39-27(22-11-7-5-8-12-22)23-13-9-6-10-14-23/h5-18,26-28,34H,19-21,32-33H2,1-4H3 |
| InChIKey | UIQGDSIYVCSUSH-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 138.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.68 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|