C30H33NO6 — CID 22817355
benzhydryl (2R)-4-(4-acetylphenoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 22817355) has the molecular formula C30H33NO6 and a molecular weight of 503.60 g/mol. Its IUPAC name is benzhydryl (2R)-4-(4-acetylphenoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | benzhydryl (2R)-4-(4-acetylphenoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 22817355 |
| Molecular Formula | C30H33NO6 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | benzhydryl (2R)-4-(4-acetylphenoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | CC(=O)c1ccc(OCC[C@@H](NC(=O)OC(C)(C)C)C(=O)OC(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H33NO6/c1-21(32)22-15-17-25(18-16-22)35-20-19-26(31-29(34)37-30(2,3)4)28(33)36-27(23-11-7-5-8-12-23)24-13-9-6-10-14-24/h5-18,26-27H,19-20H2,1-4H3,(H,31,34)/t26-/m1/s1 |
| InChIKey | MLYNIRPELNAOKG-AREMUKBSSA-N |
| XLogP | 5.88 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |