C17H32 — CID 123484692
6-tert-butyl-1,2,8a-trimethyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalene (PubChem CID 123484692) has the molecular formula C17H32 and a molecular weight of 236.44 g/mol. Its IUPAC name is 6-tert-butyl-1,2,8a-trimethyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalene.
| Compound Name | 6-tert-butyl-1,2,8a-trimethyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalene |
|---|---|
| PubChem CID | 123484692 |
| Molecular Formula | C17H32 |
| Molecular Weight | 236.44 g/mol |
| Exact Mass | 236.25 |
| IUPAC Name | 6-tert-butyl-1,2,8a-trimethyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalene |
| SMILES | CC1CCC2CC(C(C)(C)C)CCC2(C)C1C |
| InChI | InChI=1S/C17H32/c1-12-7-8-15-11-14(16(3,4)5)9-10-17(15,6)13(12)2/h12-15H,7-11H2,1-6H3 |
| InChIKey | JHHZESJBUGHXRZ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.44 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |