About dicyclohexyl 7-(6-methyloctanoyloxy)tridecanedioate
dicyclohexyl 7-(6-methyloctanoyloxy)tridecanedioate (PubChem CID 123484747) has the molecular formula C34H60O6
and a molecular weight of 564.85 g/mol. Its IUPAC name is dicyclohexyl 7-(6-methyloctanoyloxy)tridecanedioate.
Molecular Properties
| Compound Name | dicyclohexyl 7-(6-methyloctanoyloxy)tridecanedioate |
| PubChem CID | 123484747 |
| Molecular Formula | C34H60O6 |
| Molecular Weight | 564.85 g/mol |
| Exact Mass | 564.44 |
| IUPAC Name | dicyclohexyl 7-(6-methyloctanoyloxy)tridecanedioate |
| SMILES | CCC(C)CCCCC(=O)OC(CCCCCC(=O)OC1CCCCC1)CCCCCC(=O)OC1CCCCC1 |
| InChI | InChI=1S/C34H60O6/c1-3-28(2)18-16-17-27-34(37)40-31(23-12-6-14-25-32(35)38-29-19-8-4-9-20-29)24-13-7-15-26-33(36)39-30-21-10-5-11-22-30/h28-31H,3-27H2,1-2H3 |
| InChIKey | JQSRFIQHBVLYLH-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 564.85 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dicyclohexyl 7-(6-methyloctanoyloxy)tridecanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dicyclohexyl 7-(6-methyloctanoyloxy)tridecanedioate?
The IUPAC name of dicyclohexyl 7-(6-methyloctanoyloxy)tridecanedioate (CID 123484747) is dicyclohexyl 7-(6-methyloctanoyloxy)tridecanedioate.
What is the SMILES notation for dicyclohexyl 7-(6-methyloctanoyloxy)tridecanedioate?
The canonical SMILES for dicyclohexyl 7-(6-methyloctanoyloxy)tridecanedioate is CCC(C)CCCCC(=O)OC(CCCCCC(=O)OC1CCCCC1)CCCCCC(=O)OC1CCCCC1.
What is the InChIKey of dicyclohexyl 7-(6-methyloctanoyloxy)tridecanedioate?
The InChIKey is JQSRFIQHBVLYLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H60O6/c1-3-28(2)18-16-17-27-34(37)40-31(23-12-6-14-25-32(35)38-29-19-8-4-9-20-29)24-13-7-15-26-33(36)39-30-21-10-5-11-22-30/h28-31H,3-27H2,1-2H3.
What are the key properties of dicyclohexyl 7-(6-methyloctanoyloxy)tridecanedioate?
dicyclohexyl 7-(6-methyloctanoyloxy)tridecanedioate has a molecular weight of 564.85 g/mol, XLogP of 9.16, 21 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dicyclohexyl 7-(6-methyloctanoyloxy)tridecanedioate is sourced from PubChem (CID 123484747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).