C19H20N2O — CID 123485946
N-cyclobutyl-5-(3-prop-1-enylhexa-3,5-dien-1-ynyl)pyridine-2-carboxamide (PubChem CID 123485946) has the molecular formula C19H20N2O and a molecular weight of 292.38 g/mol. Its IUPAC name is N-cyclobutyl-5-(3-prop-1-enylhexa-3,5-dien-1-ynyl)pyridine-2-carboxamide.
| Compound Name | N-cyclobutyl-5-(3-prop-1-enylhexa-3,5-dien-1-ynyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 123485946 |
| Molecular Formula | C19H20N2O |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | N-cyclobutyl-5-(3-prop-1-enylhexa-3,5-dien-1-ynyl)pyridine-2-carboxamide |
| SMILES | C=CC=C(C#Cc1ccc(C(=O)NC2CCC2)nc1)C=CC |
| InChI | InChI=1S/C19H20N2O/c1-3-6-15(7-4-2)10-11-16-12-13-18(20-14-16)19(22)21-17-8-5-9-17/h3-4,6-7,12-14,17H,1,5,8-9H2,2H3,(H,21,22) |
| InChIKey | ZTAFXOUUKZHNQF-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|