C30H37F2N2O2+ — CID 123486324
[3-[2-(4-butyl-1-methylpyridin-1-ium-2-yl)-3,5-difluorophenyl]-3-ethyl-2-methylpentyl] pyridine-2-carboxylate (PubChem CID 123486324) has the molecular formula C30H37F2N2O2+ and a molecular weight of 495.63 g/mol. Its IUPAC name is [3-[2-(4-butyl-1-methylpyridin-1-ium-2-yl)-3,5-difluorophenyl]-3-ethyl-2-methylpentyl] pyridine-2-carboxylate.
| Compound Name | [3-[2-(4-butyl-1-methylpyridin-1-ium-2-yl)-3,5-difluorophenyl]-3-ethyl-2-methylpentyl] pyridine-2-carboxylate |
|---|---|
| PubChem CID | 123486324 |
| Molecular Formula | C30H37F2N2O2+ |
| Molecular Weight | 495.63 g/mol |
| Exact Mass | 495.28 |
| IUPAC Name | [3-[2-(4-butyl-1-methylpyridin-1-ium-2-yl)-3,5-difluorophenyl]-3-ethyl-2-methylpentyl] pyridine-2-carboxylate |
| SMILES | CCCCc1cc[n+](C)c(-c2c(F)cc(F)cc2C(CC)(CC)C(C)COC(=O)c2ccccn2)c1 |
| InChI | InChI=1S/C30H37F2N2O2/c1-6-9-12-22-14-16-34(5)27(17-22)28-24(18-23(31)19-25(28)32)30(7-2,8-3)21(4)20-36-29(35)26-13-10-11-15-33-26/h10-11,13-19,21H,6-9,12,20H2,1-5H3/q+1 |
| InChIKey | KKLAIEOIPKWPGK-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.63 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|