C16H18O8 — CID 123486670
acetyloxymethyl 2-(1,2-diacetyloxyethyl)benzoate (PubChem CID 123486670) has the molecular formula C16H18O8 and a molecular weight of 338.31 g/mol. Its IUPAC name is acetyloxymethyl 2-(1,2-diacetyloxyethyl)benzoate.
| Compound Name | acetyloxymethyl 2-(1,2-diacetyloxyethyl)benzoate |
|---|---|
| PubChem CID | 123486670 |
| Molecular Formula | C16H18O8 |
| Molecular Weight | 338.31 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | acetyloxymethyl 2-(1,2-diacetyloxyethyl)benzoate |
| SMILES | CC(=O)OCOC(=O)c1ccccc1C(COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C16H18O8/c1-10(17)21-8-15(24-12(3)19)13-6-4-5-7-14(13)16(20)23-9-22-11(2)18/h4-7,15H,8-9H2,1-3H3 |
| InChIKey | QKVXBJXEVHJYCH-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.31 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|