C26H29FN5O3+ — CID 123487194
[3-cyclopropyl-1-(4-fluorophenyl)-3-[11-(1-hydroxycyclobutanecarbonyl)-1-methyl-7-oxo-2,4,8,11-tetrazatricyclo[6.4.0.02,6]dodeca-3,5-dien-3-yl]prop-2-enylidene]azanium (PubChem CID 123487194) has the molecular formula C26H29FN5O3+ and a molecular weight of 478.55 g/mol. Its IUPAC name is [3-cyclopropyl-1-(4-fluorophenyl)-3-[11-(1-hydroxycyclobutanecarbonyl)-1-methyl-7-oxo-2,4,8,11-tetrazatricyclo[6.4.0.02,6]dodeca-3,5-dien-3-yl]prop-2-enylidene]azanium.
| Compound Name | [3-cyclopropyl-1-(4-fluorophenyl)-3-[11-(1-hydroxycyclobutanecarbonyl)-1-methyl-7-oxo-2,4,8,11-tetrazatricyclo[6.4.0.02,6]dodeca-3,5-dien-3-yl]prop-2-enylidene]azanium |
|---|---|
| PubChem CID | 123487194 |
| Molecular Formula | C26H29FN5O3+ |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | [3-cyclopropyl-1-(4-fluorophenyl)-3-[11-(1-hydroxycyclobutanecarbonyl)-1-methyl-7-oxo-2,4,8,11-tetrazatricyclo[6.4.0.02,6]dodeca-3,5-dien-3-yl]prop-2-enylidene]azanium |
| SMILES | CC12CN(C(=O)C3(O)CCC3)CCN1C(=O)c1cnc(C(=CC(=[NH2+])c3ccc(F)cc3)C3CC3)n12 |
| InChI | InChI=1S/C26H28FN5O3/c1-25-15-30(24(34)26(35)9-2-10-26)11-12-31(25)23(33)21-14-29-22(32(21)25)19(16-3-4-16)13-20(28)17-5-7-18(27)8-6-17/h5-8,13-14,16,28,35H,2-4,9-12,15H2,1H3/p+1 |
| InChIKey | BWWATESODVRUMS-UHFFFAOYSA-O |
| XLogP | 0.95 |
| TPSA | 104.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|