C25H27FN5O3+ — CID 123489117
15-ethyl-13-(4-fluorophenyl)-4-(1-hydroxycyclobutanecarbonyl)-2-methyl-4,7,11,12-tetraza-1-azoniatetracyclo[7.7.0.02,7.011,16]hexadeca-1(16),9,12,14-tetraen-8-one (PubChem CID 123489117) has the molecular formula C25H27FN5O3+ and a molecular weight of 464.52 g/mol. Its IUPAC name is 15-ethyl-13-(4-fluorophenyl)-4-(1-hydroxycyclobutanecarbonyl)-2-methyl-4,7,11,12-tetraza-1-azoniatetracyclo[7.7.0.02,7.011,16]hexadeca-1(16),9,12,14-tetraen-8-one.
| Compound Name | 15-ethyl-13-(4-fluorophenyl)-4-(1-hydroxycyclobutanecarbonyl)-2-methyl-4,7,11,12-tetraza-1-azoniatetracyclo[7.7.0.02,7.011,16]hexadeca-1(16),9,12,14-tetraen-8-one |
|---|---|
| PubChem CID | 123489117 |
| Molecular Formula | C25H27FN5O3+ |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 15-ethyl-13-(4-fluorophenyl)-4-(1-hydroxycyclobutanecarbonyl)-2-methyl-4,7,11,12-tetraza-1-azoniatetracyclo[7.7.0.02,7.011,16]hexadeca-1(16),9,12,14-tetraen-8-one |
| SMILES | CCc1cc(-c2ccc(F)cc2)nn2cc3[n+](c12)C1(C)CN(C(=O)C2(O)CCC2)CCN1C3=O |
| InChI | InChI=1S/C25H27FN5O3/c1-3-16-13-19(17-5-7-18(26)8-6-17)27-30-14-20-22(32)29-12-11-28(23(33)25(34)9-4-10-25)15-24(29,2)31(20)21(16)30/h5-8,13-14,34H,3-4,9-12,15H2,1-2H3/q+1 |
| InChIKey | KJUMWOGFBPUJMZ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|