C27H27FN7O2+ — CID 123660111
13-(4-fluoro-3-methylphenyl)-2-methyl-15-propan-2-yl-4-(pyrimidine-2-carbonyl)-4,7,11,12-tetraza-1-azoniatetracyclo[7.7.0.02,7.011,16]hexadeca-1(16),9,12,14-tetraen-8-one (PubChem CID 123660111) has the molecular formula C27H27FN7O2+ and a molecular weight of 500.56 g/mol. Its IUPAC name is 13-(4-fluoro-3-methylphenyl)-2-methyl-15-propan-2-yl-4-(pyrimidine-2-carbonyl)-4,7,11,12-tetraza-1-azoniatetracyclo[7.7.0.02,7.011,16]hexadeca-1(16),9,12,14-tetraen-8-one.
| Compound Name | 13-(4-fluoro-3-methylphenyl)-2-methyl-15-propan-2-yl-4-(pyrimidine-2-carbonyl)-4,7,11,12-tetraza-1-azoniatetracyclo[7.7.0.02,7.011,16]hexadeca-1(16),9,12,14-tetraen-8-one |
|---|---|
| PubChem CID | 123660111 |
| Molecular Formula | C27H27FN7O2+ |
| Molecular Weight | 500.56 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | 13-(4-fluoro-3-methylphenyl)-2-methyl-15-propan-2-yl-4-(pyrimidine-2-carbonyl)-4,7,11,12-tetraza-1-azoniatetracyclo[7.7.0.02,7.011,16]hexadeca-1(16),9,12,14-tetraen-8-one |
| SMILES | Cc1cc(-c2cc(C(C)C)c3n(cc4[n+]3C3(C)CN(C(=O)c5ncccn5)CCN3C4=O)n2)ccc1F |
| InChI | InChI=1S/C27H27FN7O2/c1-16(2)19-13-21(18-6-7-20(28)17(3)12-18)31-34-14-22-25(36)33-11-10-32(15-27(33,4)35(22)24(19)34)26(37)23-29-8-5-9-30-23/h5-9,12-14,16H,10-11,15H2,1-4H3/q+1 |
| InChIKey | GGEKQFYQSCFSBF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 87.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.56 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|