C10H15NO — CID 123487270
(2Z,5Z)-5-methoxy-6-methylocta-2,5,7-trien-4-imine (PubChem CID 123487270) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is (2Z,5Z)-5-methoxy-6-methylocta-2,5,7-trien-4-imine.
| Compound Name | (2Z,5Z)-5-methoxy-6-methylocta-2,5,7-trien-4-imine |
|---|---|
| PubChem CID | 123487270 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | (2Z,5Z)-5-methoxy-6-methylocta-2,5,7-trien-4-imine |
| SMILES | [H]/N=C(\C=C/C)C(/OC)=C(\C)C=C |
| InChI | InChI=1S/C10H15NO/c1-5-7-9(11)10(12-4)8(3)6-2/h5-7,11H,2H2,1,3-4H3/b7-5-,10-8-,11-9+ |
| InChIKey | XCQCUOWYZLHVES-IZYYEFCUSA-N |
| XLogP | 2.69 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|