C19H23N3O4 — CID 123487680
5-methoxy-6-[[6-(4-methylphenyl)oxan-2-yl]methylamino]pyrimidine-4-carboxylic acid (PubChem CID 123487680) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is 5-methoxy-6-[[6-(4-methylphenyl)oxan-2-yl]methylamino]pyrimidine-4-carboxylic acid.
| Compound Name | 5-methoxy-6-[[6-(4-methylphenyl)oxan-2-yl]methylamino]pyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 123487680 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 5-methoxy-6-[[6-(4-methylphenyl)oxan-2-yl]methylamino]pyrimidine-4-carboxylic acid |
| SMILES | COc1c(NCC2CCCC(c3ccc(C)cc3)O2)ncnc1C(=O)O |
| InChI | InChI=1S/C19H23N3O4/c1-12-6-8-13(9-7-12)15-5-3-4-14(26-15)10-20-18-17(25-2)16(19(23)24)21-11-22-18/h6-9,11,14-15H,3-5,10H2,1-2H3,(H,23,24)(H,20,21,22) |
| InChIKey | YBGGUFWRHOPJBI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |