C21H29N3O5S — CID 175128165
ethanesulfonic acid;5-methyl-6-[[(2R,6S)-6-(4-methylphenyl)oxan-2-yl]methylamino]pyrimidine-4-carbaldehyde (PubChem CID 175128165) has the molecular formula C21H29N3O5S and a molecular weight of 435.55 g/mol. Its IUPAC name is ethanesulfonic acid;5-methyl-6-[[(2R,6S)-6-(4-methylphenyl)oxan-2-yl]methylamino]pyrimidine-4-carbaldehyde.
| Compound Name | ethanesulfonic acid;5-methyl-6-[[(2R,6S)-6-(4-methylphenyl)oxan-2-yl]methylamino]pyrimidine-4-carbaldehyde |
|---|---|
| PubChem CID | 175128165 |
| Molecular Formula | C21H29N3O5S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | ethanesulfonic acid;5-methyl-6-[[(2R,6S)-6-(4-methylphenyl)oxan-2-yl]methylamino]pyrimidine-4-carbaldehyde |
| SMILES | CCS(=O)(=O)O.Cc1ccc([C@@H]2CCC[C@H](CNc3ncnc(C=O)c3C)O2)cc1 |
| InChI | InChI=1S/C19H23N3O2.C2H6O3S/c1-13-6-8-15(9-7-13)18-5-3-4-16(24-18)10-20-19-14(2)17(11-23)21-12-22-19;1-2-6(3,4)5/h6-9,11-12,16,18H,3-5,10H2,1-2H3,(H,20,21,22);2H2,1H3,(H,3,4,5)/t16-,18+;/m1./s1 |
| InChIKey | DHDZFOCBXINRGQ-CLRXKPRGSA-N |
| XLogP | 3.52 |
| TPSA | 118.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|