C20H26ClN3O3 — CID 123941127
[6-[[6-(4-chlorophenyl)oxan-2-yl]methylamino]-5-methylpyrimidin-4-yl]-ethoxymethanol (PubChem CID 123941127) has the molecular formula C20H26ClN3O3 and a molecular weight of 391.90 g/mol. Its IUPAC name is [6-[[6-(4-chlorophenyl)oxan-2-yl]methylamino]-5-methylpyrimidin-4-yl]-ethoxymethanol.
| Compound Name | [6-[[6-(4-chlorophenyl)oxan-2-yl]methylamino]-5-methylpyrimidin-4-yl]-ethoxymethanol |
|---|---|
| PubChem CID | 123941127 |
| Molecular Formula | C20H26ClN3O3 |
| Molecular Weight | 391.90 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | [6-[[6-(4-chlorophenyl)oxan-2-yl]methylamino]-5-methylpyrimidin-4-yl]-ethoxymethanol |
| SMILES | CCOC(O)c1ncnc(NCC2CCCC(c3ccc(Cl)cc3)O2)c1C |
| InChI | InChI=1S/C20H26ClN3O3/c1-3-26-20(25)18-13(2)19(24-12-23-18)22-11-16-5-4-6-17(27-16)14-7-9-15(21)10-8-14/h7-10,12,16-17,20,25H,3-6,11H2,1-2H3,(H,22,23,24) |
| InChIKey | ITUYGILREUDYJQ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 76.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.90 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|