C25H34F3N4O2+ — CID 123487760
1-[4-[2-[2-[4-(4-ethyl-5H-1,2,4-triazin-4-ium-4-yl)phenoxy]ethyl]cyclopropyl]piperidin-1-yl]-4,4,4-trifluorobutan-1-one (PubChem CID 123487760) has the molecular formula C25H34F3N4O2+ and a molecular weight of 479.57 g/mol. Its IUPAC name is 1-[4-[2-[2-[4-(4-ethyl-5H-1,2,4-triazin-4-ium-4-yl)phenoxy]ethyl]cyclopropyl]piperidin-1-yl]-4,4,4-trifluorobutan-1-one.
| Compound Name | 1-[4-[2-[2-[4-(4-ethyl-5H-1,2,4-triazin-4-ium-4-yl)phenoxy]ethyl]cyclopropyl]piperidin-1-yl]-4,4,4-trifluorobutan-1-one |
|---|---|
| PubChem CID | 123487760 |
| Molecular Formula | C25H34F3N4O2+ |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.26 |
| IUPAC Name | 1-[4-[2-[2-[4-(4-ethyl-5H-1,2,4-triazin-4-ium-4-yl)phenoxy]ethyl]cyclopropyl]piperidin-1-yl]-4,4,4-trifluorobutan-1-one |
| SMILES | CC[N+]1(c2ccc(OCCC3CC3C3CCN(C(=O)CCC(F)(F)F)CC3)cc2)C=NN=CC1 |
| InChI | InChI=1S/C25H34F3N4O2/c1-2-32(15-12-29-30-18-32)21-3-5-22(6-4-21)34-16-10-20-17-23(20)19-8-13-31(14-9-19)24(33)7-11-25(26,27)28/h3-6,12,18-20,23H,2,7-11,13-17H2,1H3/q+1 |
| InChIKey | JYVBAWTZOBHQSY-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|