C39H34ClFN6O2 — CID 123488488
methyl 3-[[2-(2-chloro-5-tritylpyrrolo[2,3-b]pyrazin-7-yl)-5-fluoropyrimidin-4-yl]amino]bicyclo[2.2.2]octane-2-carboxylate (PubChem CID 123488488) has the molecular formula C39H34ClFN6O2 and a molecular weight of 673.19 g/mol. Its IUPAC name is methyl 3-[[2-(2-chloro-5-tritylpyrrolo[2,3-b]pyrazin-7-yl)-5-fluoropyrimidin-4-yl]amino]bicyclo[2.2.2]octane-2-carboxylate.
| Compound Name | methyl 3-[[2-(2-chloro-5-tritylpyrrolo[2,3-b]pyrazin-7-yl)-5-fluoropyrimidin-4-yl]amino]bicyclo[2.2.2]octane-2-carboxylate |
|---|---|
| PubChem CID | 123488488 |
| Molecular Formula | C39H34ClFN6O2 |
| Molecular Weight | 673.19 g/mol |
| Exact Mass | 672.24 |
| IUPAC Name | methyl 3-[[2-(2-chloro-5-tritylpyrrolo[2,3-b]pyrazin-7-yl)-5-fluoropyrimidin-4-yl]amino]bicyclo[2.2.2]octane-2-carboxylate |
| SMILES | COC(=O)C1C2CCC(CC2)C1Nc1nc(-c2cn(C(c3ccccc3)(c3ccccc3)c3ccccc3)c3ncc(Cl)nc23)ncc1F |
| InChI | InChI=1S/C39H34ClFN6O2/c1-49-38(48)32-24-17-19-25(20-18-24)33(32)45-36-30(41)21-42-35(46-36)29-23-47(37-34(29)44-31(40)22-43-37)39(26-11-5-2-6-12-26,27-13-7-3-8-14-27)28-15-9-4-10-16-28/h2-16,21-25,32-33H,17-20H2,1H3,(H,42,45,46) |
| InChIKey | GDDAQOYLKDRMEV-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.19 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|