C21H29N5O5S — CID 123488764
N-[7-ethyl-6-(2-methylpyrazol-3-yl)-2,4-dioxo-1H-quinazolin-3-yl]-N-(1-hydroxyhexyl)methanesulfonamide (PubChem CID 123488764) has the molecular formula C21H29N5O5S and a molecular weight of 463.56 g/mol. Its IUPAC name is N-[7-ethyl-6-(2-methylpyrazol-3-yl)-2,4-dioxo-1H-quinazolin-3-yl]-N-(1-hydroxyhexyl)methanesulfonamide.
| Compound Name | N-[7-ethyl-6-(2-methylpyrazol-3-yl)-2,4-dioxo-1H-quinazolin-3-yl]-N-(1-hydroxyhexyl)methanesulfonamide |
|---|---|
| PubChem CID | 123488764 |
| Molecular Formula | C21H29N5O5S |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | N-[7-ethyl-6-(2-methylpyrazol-3-yl)-2,4-dioxo-1H-quinazolin-3-yl]-N-(1-hydroxyhexyl)methanesulfonamide |
| SMILES | CCCCCC(O)N(n1c(=O)[nH]c2cc(CC)c(-c3ccnn3C)cc2c1=O)S(C)(=O)=O |
| InChI | InChI=1S/C21H29N5O5S/c1-5-7-8-9-19(27)26(32(4,30)31)25-20(28)16-13-15(18-10-11-22-24(18)3)14(6-2)12-17(16)23-21(25)29/h10-13,19,27H,5-9H2,1-4H3,(H,23,29) |
| InChIKey | LHOUNMGUBWZDAJ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 130.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|