C23H31NO2 — CID 123488997
1-[5-[(3-ethylphenoxy)methyl]-2-pyridinyl]-6-methyloctan-1-one (PubChem CID 123488997) has the molecular formula C23H31NO2 and a molecular weight of 353.51 g/mol. Its IUPAC name is 1-[5-[(3-ethylphenoxy)methyl]-2-pyridinyl]-6-methyloctan-1-one.
| Compound Name | 1-[5-[(3-ethylphenoxy)methyl]-2-pyridinyl]-6-methyloctan-1-one |
|---|---|
| PubChem CID | 123488997 |
| Molecular Formula | C23H31NO2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | 1-[5-[(3-ethylphenoxy)methyl]-2-pyridinyl]-6-methyloctan-1-one |
| SMILES | CCc1cccc(OCc2ccc(C(=O)CCCCC(C)CC)nc2)c1 |
| InChI | InChI=1S/C23H31NO2/c1-4-18(3)9-6-7-12-23(25)22-14-13-20(16-24-22)17-26-21-11-8-10-19(5-2)15-21/h8,10-11,13-16,18H,4-7,9,12,17H2,1-3H3 |
| InChIKey | FLMPCEXDYHDXAO-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|