C10H16N2O — CID 123489221
1-cyclopropyl-3-[(Z)-hex-4-en-3-ylidene]urea (PubChem CID 123489221) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 1-cyclopropyl-3-[(Z)-hex-4-en-3-ylidene]urea.
| Compound Name | 1-cyclopropyl-3-[(Z)-hex-4-en-3-ylidene]urea |
|---|---|
| PubChem CID | 123489221 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 1-cyclopropyl-3-[(Z)-hex-4-en-3-ylidene]urea |
| SMILES | C/C=C\C(CC)=NC(=O)NC1CC1 |
| InChI | InChI=1S/C10H16N2O/c1-3-5-8(4-2)11-10(13)12-9-6-7-9/h3,5,9H,4,6-7H2,1-2H3,(H,12,13)/b5-3-,11-8? |
| InChIKey | CBBROWRIKTXTEC-PPPCWZSVSA-N |
| XLogP | 2.29 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|