C10H22N2O2 — CID 123489935
2-(4-methylpiperazin-1-yl)pentane-1,5-diol (PubChem CID 123489935) has the molecular formula C10H22N2O2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 2-(4-methylpiperazin-1-yl)pentane-1,5-diol.
| Compound Name | 2-(4-methylpiperazin-1-yl)pentane-1,5-diol |
|---|---|
| PubChem CID | 123489935 |
| Molecular Formula | C10H22N2O2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | 2-(4-methylpiperazin-1-yl)pentane-1,5-diol |
| SMILES | CN1CCN(C(CO)CCCO)CC1 |
| InChI | InChI=1S/C10H22N2O2/c1-11-4-6-12(7-5-11)10(9-14)3-2-8-13/h10,13-14H,2-9H2,1H3 |
| InChIKey | YWRDJRWDTWZDAH-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |