C18H18N2O3 — CID 123491923
methyl 3-[[5-(5-ethynyl-2-pyridinyl)-2-pyridinyl]oxy]-2,2-dimethylpropanoate (PubChem CID 123491923) has the molecular formula C18H18N2O3 and a molecular weight of 310.35 g/mol. Its IUPAC name is methyl 3-[[5-(5-ethynyl-2-pyridinyl)-2-pyridinyl]oxy]-2,2-dimethylpropanoate.
| Compound Name | methyl 3-[[5-(5-ethynyl-2-pyridinyl)-2-pyridinyl]oxy]-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 123491923 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | methyl 3-[[5-(5-ethynyl-2-pyridinyl)-2-pyridinyl]oxy]-2,2-dimethylpropanoate |
| SMILES | C#Cc1ccc(-c2ccc(OCC(C)(C)C(=O)OC)nc2)nc1 |
| InChI | InChI=1S/C18H18N2O3/c1-5-13-6-8-15(19-10-13)14-7-9-16(20-11-14)23-12-18(2,3)17(21)22-4/h1,6-11H,12H2,2-4H3 |
| InChIKey | OYTOBYBJMROJBL-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|