C18H20IN3O3 — CID 121354306
methyl 3-[[5-(4-carbamimidoylphenyl)-4-iodo-2-pyridinyl]oxy]-2,2-dimethylpropanoate (PubChem CID 121354306) has the molecular formula C18H20IN3O3 and a molecular weight of 453.28 g/mol. Its IUPAC name is methyl 3-[[5-(4-carbamimidoylphenyl)-4-iodo-2-pyridinyl]oxy]-2,2-dimethylpropanoate.
| Compound Name | methyl 3-[[5-(4-carbamimidoylphenyl)-4-iodo-2-pyridinyl]oxy]-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 121354306 |
| Molecular Formula | C18H20IN3O3 |
| Molecular Weight | 453.28 g/mol |
| Exact Mass | 453.05 |
| IUPAC Name | methyl 3-[[5-(4-carbamimidoylphenyl)-4-iodo-2-pyridinyl]oxy]-2,2-dimethylpropanoate |
| SMILES | [H]/N=C(\N)c1ccc(-c2cnc(OCC(C)(C)C(=O)OC)cc2I)cc1 |
| InChI | InChI=1S/C18H20IN3O3/c1-18(2,17(23)24-3)10-25-15-8-14(19)13(9-22-15)11-4-6-12(7-5-11)16(20)21/h4-9H,10H2,1-3H3,(H3,20,21) |
| InChIKey | BUWIQRIFBWLNDJ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 98.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.28 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|