C19H25NO8 — CID 14210544
bis(3-methoxy-2,2-dimethyl-3-oxopropyl) pyridine-2,5-dicarboxylate (PubChem CID 14210544) has the molecular formula C19H25NO8 and a molecular weight of 395.41 g/mol. Its IUPAC name is bis(3-methoxy-2,2-dimethyl-3-oxopropyl) pyridine-2,5-dicarboxylate.
| Compound Name | bis(3-methoxy-2,2-dimethyl-3-oxopropyl) pyridine-2,5-dicarboxylate |
|---|---|
| PubChem CID | 14210544 |
| Molecular Formula | C19H25NO8 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | bis(3-methoxy-2,2-dimethyl-3-oxopropyl) pyridine-2,5-dicarboxylate |
| SMILES | COC(=O)C(C)(C)COC(=O)c1ccc(C(=O)OCC(C)(C)C(=O)OC)nc1 |
| InChI | InChI=1S/C19H25NO8/c1-18(2,16(23)25-5)10-27-14(21)12-7-8-13(20-9-12)15(22)28-11-19(3,4)17(24)26-6/h7-9H,10-11H2,1-6H3 |
| InChIKey | BABHGVBGLUZSTB-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 118.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|