C13H17NO4 — CID 79620793
(3-methoxy-2,2-dimethyl-3-oxopropyl) 3-aminobenzoate (PubChem CID 79620793) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is (3-methoxy-2,2-dimethyl-3-oxopropyl) 3-aminobenzoate.
| Compound Name | (3-methoxy-2,2-dimethyl-3-oxopropyl) 3-aminobenzoate |
|---|---|
| PubChem CID | 79620793 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | (3-methoxy-2,2-dimethyl-3-oxopropyl) 3-aminobenzoate |
| SMILES | COC(=O)C(C)(C)COC(=O)c1cccc(N)c1 |
| InChI | InChI=1S/C13H17NO4/c1-13(2,12(16)17-3)8-18-11(15)9-5-4-6-10(14)7-9/h4-7H,8,14H2,1-3H3 |
| InChIKey | LJYMHHVQEQQIMD-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|