C9H16 — CID 123492545
1,2,3-trimethyl-1-prop-1-enylcyclopropane (PubChem CID 123492545) has the molecular formula C9H16 and a molecular weight of 124.23 g/mol. Its IUPAC name is 1,2,3-trimethyl-1-prop-1-enylcyclopropane.
| Compound Name | 1,2,3-trimethyl-1-prop-1-enylcyclopropane |
|---|---|
| PubChem CID | 123492545 |
| Molecular Formula | C9H16 |
| Molecular Weight | 124.23 g/mol |
| Exact Mass | 124.13 |
| IUPAC Name | 1,2,3-trimethyl-1-prop-1-enylcyclopropane |
| SMILES | CC=CC1(C)C(C)C1C |
| InChI | InChI=1S/C9H16/c1-5-6-9(4)7(2)8(9)3/h5-8H,1-4H3 |
| InChIKey | MDAJHSKMYXQREU-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.23 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|