About 3,5-diethyl-1-fluoro-2,4-dimethylcyclopenta-1,3-diene
3,5-diethyl-1-fluoro-2,4-dimethylcyclopenta-1,3-diene (PubChem CID 123492675) has the molecular formula C11H17F
and a molecular weight of 168.25 g/mol. Its IUPAC name is 3,5-diethyl-1-fluoro-2,4-dimethylcyclopenta-1,3-diene.
Analyze 3,5-diethyl-1-fluoro-2,4-dimethylcyclopenta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-diethyl-1-fluoro-2,4-dimethylcyclopenta-1,3-diene?
The IUPAC name of 3,5-diethyl-1-fluoro-2,4-dimethylcyclopenta-1,3-diene (CID 123492675) is 3,5-diethyl-1-fluoro-2,4-dimethylcyclopenta-1,3-diene.
What is the SMILES notation for 3,5-diethyl-1-fluoro-2,4-dimethylcyclopenta-1,3-diene?
The canonical SMILES for 3,5-diethyl-1-fluoro-2,4-dimethylcyclopenta-1,3-diene is CCC1=C(C)C(CC)C(F)=C1C.
What is the InChIKey of 3,5-diethyl-1-fluoro-2,4-dimethylcyclopenta-1,3-diene?
The InChIKey is LNSBLDJIXZHAMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F/c1-5-9-7(3)10(6-2)11(12)8(9)4/h10H,5-6H2,1-4H3.
What are the key properties of 3,5-diethyl-1-fluoro-2,4-dimethylcyclopenta-1,3-diene?
3,5-diethyl-1-fluoro-2,4-dimethylcyclopenta-1,3-diene has a molecular weight of 168.25 g/mol, XLogP of 4.00, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diethyl-1-fluoro-2,4-dimethylcyclopenta-1,3-diene is sourced from PubChem (CID 123492675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).