About 6-chloro-5-fluoro-2,5-dihydropyridine
6-chloro-5-fluoro-2,5-dihydropyridine (PubChem CID 123494833) has the molecular formula C5H5ClFN
and a molecular weight of 133.55 g/mol. Its IUPAC name is 6-chloro-5-fluoro-2,5-dihydropyridine.
Molecular Properties
| Compound Name | 6-chloro-5-fluoro-2,5-dihydropyridine |
| PubChem CID | 123494833 |
| Molecular Formula | C5H5ClFN |
| Molecular Weight | 133.55 g/mol |
| Exact Mass | 133.01 |
| IUPAC Name | 6-chloro-5-fluoro-2,5-dihydropyridine |
| SMILES | FC1C=CCN=C1Cl |
| InChI | InChI=1S/C5H5ClFN/c6-5-4(7)2-1-3-8-5/h1-2,4H,3H2 |
| InChIKey | HXXMPYTTZMEETM-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.55 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-5-fluoro-2,5-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-5-fluoro-2,5-dihydropyridine?
The IUPAC name of 6-chloro-5-fluoro-2,5-dihydropyridine (CID 123494833) is 6-chloro-5-fluoro-2,5-dihydropyridine.
What is the SMILES notation for 6-chloro-5-fluoro-2,5-dihydropyridine?
The canonical SMILES for 6-chloro-5-fluoro-2,5-dihydropyridine is FC1C=CCN=C1Cl.
What is the InChIKey of 6-chloro-5-fluoro-2,5-dihydropyridine?
The InChIKey is HXXMPYTTZMEETM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5ClFN/c6-5-4(7)2-1-3-8-5/h1-2,4H,3H2.
What are the key properties of 6-chloro-5-fluoro-2,5-dihydropyridine?
6-chloro-5-fluoro-2,5-dihydropyridine has a molecular weight of 133.55 g/mol, XLogP of 1.53, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-5-fluoro-2,5-dihydropyridine is sourced from PubChem (CID 123494833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).