C5H5Cl2N — CID 91378461
2,6-dichloro-2,5-dihydropyridine (PubChem CID 91378461) has the molecular formula C5H5Cl2N and a molecular weight of 150.01 g/mol. Its IUPAC name is 2,6-dichloro-2,5-dihydropyridine.
| Compound Name | 2,6-dichloro-2,5-dihydropyridine |
|---|---|
| PubChem CID | 91378461 |
| Molecular Formula | C5H5Cl2N |
| Molecular Weight | 150.01 g/mol |
| Exact Mass | 148.98 |
| IUPAC Name | 2,6-dichloro-2,5-dihydropyridine |
| SMILES | ClC1=NC(Cl)C=CC1 |
| InChI | InChI=1S/C5H5Cl2N/c6-4-2-1-3-5(7)8-4/h1-2,4H,3H2 |
| InChIKey | BEBRWLUPRMGCPZ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.01 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|