C11H22N2+2 — CID 123494882
ethylidene-methyl-[2-(1,1,3-trimethylazirin-1-ium-2-yl)propyl]azanium (PubChem CID 123494882) has the molecular formula C11H22N2+2 and a molecular weight of 182.31 g/mol. Its IUPAC name is ethylidene-methyl-[2-(1,1,3-trimethylazirin-1-ium-2-yl)propyl]azanium.
| Compound Name | ethylidene-methyl-[2-(1,1,3-trimethylazirin-1-ium-2-yl)propyl]azanium |
|---|---|
| PubChem CID | 123494882 |
| Molecular Formula | C11H22N2+2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | ethylidene-methyl-[2-(1,1,3-trimethylazirin-1-ium-2-yl)propyl]azanium |
| SMILES | C/C=[N+](\C)CC(C)C1=C(C)[N+]1(C)C |
| InChI | InChI=1S/C11H22N2/c1-7-12(4)8-9(2)11-10(3)13(11,5)6/h7,9H,8H2,1-6H3/q+2/b12-7+ |
| InChIKey | BXQLYMGUBLLJAL-KPKJPENVSA-N |
| XLogP | 1.68 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|