C15H32N2 — CID 170634492
butane;N-(1,5-dimethyl-3,6-dihydro-2H-pyridin-4-yl)ethanimine;ethane (PubChem CID 170634492) has the molecular formula C15H32N2 and a molecular weight of 240.43 g/mol. Its IUPAC name is butane;N-(1,5-dimethyl-3,6-dihydro-2H-pyridin-4-yl)ethanimine;ethane.
| Compound Name | butane;N-(1,5-dimethyl-3,6-dihydro-2H-pyridin-4-yl)ethanimine;ethane |
|---|---|
| PubChem CID | 170634492 |
| Molecular Formula | C15H32N2 |
| Molecular Weight | 240.43 g/mol |
| Exact Mass | 240.26 |
| IUPAC Name | butane;N-(1,5-dimethyl-3,6-dihydro-2H-pyridin-4-yl)ethanimine;ethane |
| SMILES | C/C=N/C1=C(C)CN(C)CC1.CC.CCCC |
| InChI | InChI=1S/C9H16N2.C4H10.C2H6/c1-4-10-9-5-6-11(3)7-8(9)2;1-3-4-2;1-2/h4H,5-7H2,1-3H3;3-4H2,1-2H3;1-2H3/b10-4+;; |
| InChIKey | GZKNWRZQRVBNHM-JPRUNYMKSA-N |
| XLogP | 4.52 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.43 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|